C21H18ClN3O — CID 69189312
1-benzyl-N-(3-chlorophenyl)-5-methoxyindazol-3-amine (PubChem CID 69189312) has the molecular formula C21H18ClN3O and a molecular weight of 363.85 g/mol. Its IUPAC name is 1-benzyl-N-(3-chlorophenyl)-5-methoxyindazol-3-amine.
| Compound Name | 1-benzyl-N-(3-chlorophenyl)-5-methoxyindazol-3-amine |
|---|---|
| PubChem CID | 69189312 |
| Molecular Formula | C21H18ClN3O |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-benzyl-N-(3-chlorophenyl)-5-methoxyindazol-3-amine |
| SMILES | COc1ccc2c(c1)c(Nc1cccc(Cl)c1)nn2Cc1ccccc1 |
| InChI | InChI=1S/C21H18ClN3O/c1-26-18-10-11-20-19(13-18)21(23-17-9-5-8-16(22)12-17)24-25(20)14-15-6-3-2-4-7-15/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | AFBCZKYBGQITCS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |