C20H15ClFN3O3S — CID 69189190
1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)-5-methoxyindazol-3-amine (PubChem CID 69189190) has the molecular formula C20H15ClFN3O3S and a molecular weight of 431.88 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)-5-methoxyindazol-3-amine.
| Compound Name | 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)-5-methoxyindazol-3-amine |
|---|---|
| PubChem CID | 69189190 |
| Molecular Formula | C20H15ClFN3O3S |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3-chloro-4-fluorophenyl)-5-methoxyindazol-3-amine |
| SMILES | COc1ccc2c(c1)c(Nc1ccc(F)c(Cl)c1)nn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H15ClFN3O3S/c1-28-14-8-10-19-16(12-14)20(23-13-7-9-18(22)17(21)11-13)24-25(19)29(26,27)15-5-3-2-4-6-15/h2-12H,1H3,(H,23,24) |
| InChIKey | MPHWEFVRZMDDGA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |