C22H20N4O3S — CID 121238392
1-(4-methoxyphenyl)sulfonyl-3-N,5-N-diphenylpyrazole-3,5-diamine (PubChem CID 121238392) has the molecular formula C22H20N4O3S and a molecular weight of 420.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-3-N,5-N-diphenylpyrazole-3,5-diamine.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-3-N,5-N-diphenylpyrazole-3,5-diamine |
|---|---|
| PubChem CID | 121238392 |
| Molecular Formula | C22H20N4O3S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-3-N,5-N-diphenylpyrazole-3,5-diamine |
| SMILES | COc1ccc(S(=O)(=O)n2nc(Nc3ccccc3)cc2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N4O3S/c1-29-19-12-14-20(15-13-19)30(27,28)26-22(24-18-10-6-3-7-11-18)16-21(25-26)23-17-8-4-2-5-9-17/h2-16,24H,1H3,(H,23,25) |
| InChIKey | BFVFAKRRGPAUMD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |