C24H22N4O3 — CID 121238403
[3,5-bis(4-methoxyanilino)pyrazol-1-yl]-phenylmethanone (PubChem CID 121238403) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is [3,5-bis(4-methoxyanilino)pyrazol-1-yl]-phenylmethanone.
| Compound Name | [3,5-bis(4-methoxyanilino)pyrazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 121238403 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [3,5-bis(4-methoxyanilino)pyrazol-1-yl]-phenylmethanone |
| SMILES | COc1ccc(Nc2cc(Nc3ccc(OC)cc3)n(C(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-30-20-12-8-18(9-13-20)25-22-16-23(26-19-10-14-21(31-2)15-11-19)28(27-22)24(29)17-6-4-3-5-7-17/h3-16,26H,1-2H3,(H,25,27) |
| InChIKey | LWXXAMFJFGNQOU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |