C24H29N5O2S — CID 121238478
N-cyclohexyl-3,5-bis(4-methoxyanilino)pyrazole-1-carbothioamide (PubChem CID 121238478) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is N-cyclohexyl-3,5-bis(4-methoxyanilino)pyrazole-1-carbothioamide.
| Compound Name | N-cyclohexyl-3,5-bis(4-methoxyanilino)pyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 121238478 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-cyclohexyl-3,5-bis(4-methoxyanilino)pyrazole-1-carbothioamide |
| SMILES | COc1ccc(Nc2cc(Nc3ccc(OC)cc3)n(C(=S)NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C24H29N5O2S/c1-30-20-12-8-18(9-13-20)25-22-16-23(26-19-10-14-21(31-2)15-11-19)29(28-22)24(32)27-17-6-4-3-5-7-17/h8-17,26H,3-7H2,1-2H3,(H,25,28)(H,27,32) |
| InChIKey | UWYSPRYIJSSHEV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 72.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|