C25H30N6O2 — CID 50753143
1-[4-[[6-(cyclohexylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 50753143) has the molecular formula C25H30N6O2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 1-[4-[[6-(cyclohexylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-[[6-(cyclohexylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 50753143 |
| Molecular Formula | C25H30N6O2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[4-[[6-(cyclohexylamino)-2-methylpyrimidin-4-yl]amino]phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(Nc3cc(NC4CCCCC4)nc(C)n3)cc2)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-17-26-23(28-18-7-4-3-5-8-18)16-24(27-17)29-19-11-13-20(14-12-19)30-25(32)31-21-9-6-10-22(15-21)33-2/h6,9-16,18H,3-5,7-8H2,1-2H3,(H2,30,31,32)(H2,26,27,28,29) |
| InChIKey | NRVKALRLSKVWPA-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |