C18H25N5O — CID 19149168
4-N-cycloheptyl-6-N-(4-methoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19149168) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-N-(4-methoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cycloheptyl-6-N-(4-methoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19149168 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 4-N-cycloheptyl-6-N-(4-methoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | COc1ccc(Nc2ncnc(NC3CCCCCC3)c2N)cc1 |
| InChI | InChI=1S/C18H25N5O/c1-24-15-10-8-14(9-11-15)23-18-16(19)17(20-12-21-18)22-13-6-4-2-3-5-7-13/h8-13H,2-7,19H2,1H3,(H2,20,21,22,23) |
| InChIKey | HWLKSSISXQOBKJ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |