C15H19N5 — CID 19147747
4-N-cyclopentyl-6-N-phenylpyrimidine-4,5,6-triamine (PubChem CID 19147747) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-phenylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cyclopentyl-6-N-phenylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19147747 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4-N-cyclopentyl-6-N-phenylpyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccccc2)ncnc1NC1CCCC1 |
| InChI | InChI=1S/C15H19N5/c16-13-14(19-11-6-2-1-3-7-11)17-10-18-15(13)20-12-8-4-5-9-12/h1-3,6-7,10,12H,4-5,8-9,16H2,(H2,17,18,19,20) |
| InChIKey | ZARYACIEDNEEFY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |