C17H23N5 — CID 22544200
4-N-cyclopentyl-6-N-(2-ethylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22544200) has the molecular formula C17H23N5 and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-N-cyclopentyl-6-N-(2-ethylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-cyclopentyl-6-N-(2-ethylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22544200 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 4-N-cyclopentyl-6-N-(2-ethylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCc1ccccc1Nc1ncnc(NC2CCCC2)c1N |
| InChI | InChI=1S/C17H23N5/c1-2-12-7-3-6-10-14(12)22-17-15(18)16(19-11-20-17)21-13-8-4-5-9-13/h3,6-7,10-11,13H,2,4-5,8-9,18H2,1H3,(H2,19,20,21,22) |
| InChIKey | UUVCLVVJKSJTJV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |