C21H31N5O — CID 19143097
6-N-(4-butoxyphenyl)-4-N-cycloheptylpyrimidine-4,5,6-triamine (PubChem CID 19143097) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-cycloheptylpyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-cycloheptylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19143097 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-cycloheptylpyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(NC3CCCCCC3)c2N)cc1 |
| InChI | InChI=1S/C21H31N5O/c1-2-3-14-27-18-12-10-17(11-13-18)26-21-19(22)20(23-15-24-21)25-16-8-6-4-5-7-9-16/h10-13,15-16H,2-9,14,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | XZUPKAUCYXXDJP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|