C17H15ClFN3 — CID 21003823
N-(3-chloro-4-fluorophenyl)-2-propan-2-ylquinazolin-4-amine (PubChem CID 21003823) has the molecular formula C17H15ClFN3 and a molecular weight of 315.78 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-propan-2-ylquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-propan-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 21003823 |
| Molecular Formula | C17H15ClFN3 |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-propan-2-ylquinazolin-4-amine |
| SMILES | CC(C)c1nc(Nc2ccc(F)c(Cl)c2)c2ccccc2n1 |
| InChI | InChI=1S/C17H15ClFN3/c1-10(2)16-21-15-6-4-3-5-12(15)17(22-16)20-11-7-8-14(19)13(18)9-11/h3-10H,1-2H3,(H,20,21,22) |
| InChIKey | CUBHQHSQOJJTHH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |