C17H18N4O2S — CID 110434808
4-[(2-propan-2-ylquinazolin-4-yl)amino]benzenesulfonamide (PubChem CID 110434808) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 4-[(2-propan-2-ylquinazolin-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(2-propan-2-ylquinazolin-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 110434808 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 4-[(2-propan-2-ylquinazolin-4-yl)amino]benzenesulfonamide |
| SMILES | CC(C)c1nc(Nc2ccc(S(N)(=O)=O)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-11(2)16-20-15-6-4-3-5-14(15)17(21-16)19-12-7-9-13(10-8-12)24(18,22)23/h3-11H,1-2H3,(H2,18,22,23)(H,19,20,21) |
| InChIKey | UMBFDINWNZEPLF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |