C12H14N4O2S — CID 82059643
4-[(3-amino-6-methyl-2-pyridinyl)amino]benzenesulfonamide (PubChem CID 82059643) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 4-[(3-amino-6-methyl-2-pyridinyl)amino]benzenesulfonamide.
| Compound Name | 4-[(3-amino-6-methyl-2-pyridinyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 82059643 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-[(3-amino-6-methyl-2-pyridinyl)amino]benzenesulfonamide |
| SMILES | Cc1ccc(N)c(Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C12H14N4O2S/c1-8-2-7-11(13)12(15-8)16-9-3-5-10(6-4-9)19(14,17)18/h2-7H,13H2,1H3,(H,15,16)(H2,14,17,18) |
| InChIKey | CGBBJGKIAJKEHS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |