C16H10ClF4N3 — CID 21003580
N-(3-chloro-4-fluorophenyl)-6-methyl-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 21003580) has the molecular formula C16H10ClF4N3 and a molecular weight of 355.72 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6-methyl-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6-methyl-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 21003580 |
| Molecular Formula | C16H10ClF4N3 |
| Molecular Weight | 355.72 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6-methyl-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Cc1ccc2nc(C(F)(F)F)nc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C16H10ClF4N3/c1-8-2-5-13-10(6-8)14(24-15(23-13)16(19,20)21)22-9-3-4-12(18)11(17)7-9/h2-7H,1H3,(H,22,23,24) |
| InChIKey | KKWAQHTTZNBNHM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.72 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |