C10H7ClF3N3 — CID 64981065
6-chloro-N-methyl-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 64981065) has the molecular formula C10H7ClF3N3 and a molecular weight of 261.63 g/mol. Its IUPAC name is 6-chloro-N-methyl-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 6-chloro-N-methyl-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 64981065 |
| Molecular Formula | C10H7ClF3N3 |
| Molecular Weight | 261.63 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 6-chloro-N-methyl-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CNc1nc(C(F)(F)F)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C10H7ClF3N3/c1-15-8-6-4-5(11)2-3-7(6)16-9(17-8)10(12,13)14/h2-4H,1H3,(H,15,16,17) |
| InChIKey | NZFMTWPPFNTNJP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |