C15H10ClF2N3 — CID 64981014
6-chloro-2-(2,6-difluorophenyl)-N-methylquinazolin-4-amine (PubChem CID 64981014) has the molecular formula C15H10ClF2N3 and a molecular weight of 305.72 g/mol. Its IUPAC name is 6-chloro-2-(2,6-difluorophenyl)-N-methylquinazolin-4-amine.
| Compound Name | 6-chloro-2-(2,6-difluorophenyl)-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 64981014 |
| Molecular Formula | C15H10ClF2N3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 6-chloro-2-(2,6-difluorophenyl)-N-methylquinazolin-4-amine |
| SMILES | CNc1nc(-c2c(F)cccc2F)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H10ClF2N3/c1-19-14-9-7-8(16)5-6-12(9)20-15(21-14)13-10(17)3-2-4-11(13)18/h2-7H,1H3,(H,19,20,21) |
| InChIKey | FGUYSIVYSFLWKE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |