C15H11F2N3 — CID 64980918
6-fluoro-2-(4-fluorophenyl)-N-methylquinazolin-4-amine (PubChem CID 64980918) has the molecular formula C15H11F2N3 and a molecular weight of 271.27 g/mol. Its IUPAC name is 6-fluoro-2-(4-fluorophenyl)-N-methylquinazolin-4-amine.
| Compound Name | 6-fluoro-2-(4-fluorophenyl)-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 64980918 |
| Molecular Formula | C15H11F2N3 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 6-fluoro-2-(4-fluorophenyl)-N-methylquinazolin-4-amine |
| SMILES | CNc1nc(-c2ccc(F)cc2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C15H11F2N3/c1-18-15-12-8-11(17)6-7-13(12)19-14(20-15)9-2-4-10(16)5-3-9/h2-8H,1H3,(H,18,19,20) |
| InChIKey | OENDZYXFFHBYQQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |