C17H16ClN3 — CID 64981583
2-(3-chloro-4-methylphenyl)-N,6-dimethylquinazolin-4-amine (PubChem CID 64981583) has the molecular formula C17H16ClN3 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-(3-chloro-4-methylphenyl)-N,6-dimethylquinazolin-4-amine.
| Compound Name | 2-(3-chloro-4-methylphenyl)-N,6-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 64981583 |
| Molecular Formula | C17H16ClN3 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-(3-chloro-4-methylphenyl)-N,6-dimethylquinazolin-4-amine |
| SMILES | CNc1nc(-c2ccc(C)c(Cl)c2)nc2ccc(C)cc12 |
| InChI | InChI=1S/C17H16ClN3/c1-10-4-7-15-13(8-10)17(19-3)21-16(20-15)12-6-5-11(2)14(18)9-12/h4-9H,1-3H3,(H,19,20,21) |
| InChIKey | QZGVTNXZXUBMON-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |