C15H9F4N3 — CID 110434628
6-fluoro-N-phenyl-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110434628) has the molecular formula C15H9F4N3 and a molecular weight of 307.25 g/mol. Its IUPAC name is 6-fluoro-N-phenyl-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 6-fluoro-N-phenyl-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110434628 |
| Molecular Formula | C15H9F4N3 |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 6-fluoro-N-phenyl-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Fc1ccc2nc(C(F)(F)F)nc(Nc3ccccc3)c2c1 |
| InChI | InChI=1S/C15H9F4N3/c16-9-6-7-12-11(8-9)13(20-10-4-2-1-3-5-10)22-14(21-12)15(17,18)19/h1-8H,(H,20,21,22) |
| InChIKey | PYCCGBKSNPWYNV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |