C15H10F4N4 — CID 110431666
6-fluoro-N-(pyridin-3-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 110431666) has the molecular formula C15H10F4N4 and a molecular weight of 322.27 g/mol. Its IUPAC name is 6-fluoro-N-(pyridin-3-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | 6-fluoro-N-(pyridin-3-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 110431666 |
| Molecular Formula | C15H10F4N4 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-fluoro-N-(pyridin-3-ylmethyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | Fc1ccc2nc(C(F)(F)F)nc(NCc3cccnc3)c2c1 |
| InChI | InChI=1S/C15H10F4N4/c16-10-3-4-12-11(6-10)13(23-14(22-12)15(17,18)19)21-8-9-2-1-5-20-7-9/h1-7H,8H2,(H,21,22,23) |
| InChIKey | BDNOCVWWGPBATL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |