C24H21F3N4 — CID 5330928
N-tert-butyl-6-(3-pyridin-3-ylphenyl)-2-(trifluoromethyl)quinazolin-4-amine (PubChem CID 5330928) has the molecular formula C24H21F3N4 and a molecular weight of 422.45 g/mol. Its IUPAC name is N-tert-butyl-6-(3-pyridin-3-ylphenyl)-2-(trifluoromethyl)quinazolin-4-amine.
| Compound Name | N-tert-butyl-6-(3-pyridin-3-ylphenyl)-2-(trifluoromethyl)quinazolin-4-amine |
|---|---|
| PubChem CID | 5330928 |
| Molecular Formula | C24H21F3N4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-tert-butyl-6-(3-pyridin-3-ylphenyl)-2-(trifluoromethyl)quinazolin-4-amine |
| SMILES | CC(C)(C)Nc1nc(C(F)(F)F)nc2ccc(-c3cccc(-c4cccnc4)c3)cc12 |
| InChI | InChI=1S/C24H21F3N4/c1-23(2,3)31-21-19-13-17(9-10-20(19)29-22(30-21)24(25,26)27)15-6-4-7-16(12-15)18-8-5-11-28-14-18/h4-14H,1-3H3,(H,29,30,31) |
| InChIKey | HIAOBDKARZRIQC-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |