C19H16Cl2FN5 — CID 151745087
2-chloro-N-(3-chloro-4-fluorophenyl)-6-[3-(2,2-dimethylhydrazinyl)prop-1-ynyl]quinazolin-4-amine (PubChem CID 151745087) has the molecular formula C19H16Cl2FN5 and a molecular weight of 404.28 g/mol. Its IUPAC name is 2-chloro-N-(3-chloro-4-fluorophenyl)-6-[3-(2,2-dimethylhydrazinyl)prop-1-ynyl]quinazolin-4-amine.
| Compound Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-6-[3-(2,2-dimethylhydrazinyl)prop-1-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 151745087 |
| Molecular Formula | C19H16Cl2FN5 |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-chloro-N-(3-chloro-4-fluorophenyl)-6-[3-(2,2-dimethylhydrazinyl)prop-1-ynyl]quinazolin-4-amine |
| SMILES | CN(C)NCC#Cc1ccc2nc(Cl)nc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C19H16Cl2FN5/c1-27(2)23-9-3-4-12-5-8-17-14(10-12)18(26-19(21)25-17)24-13-6-7-16(22)15(20)11-13/h5-8,10-11,23H,9H2,1-2H3,(H,24,25,26) |
| InChIKey | RNIQNYOOBYGEQB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|