C16H13ClN2O4S — CID 123883844
[1-(4-chlorobenzoyl)-5-methoxyindazol-3-yl]methanesulfinic acid (PubChem CID 123883844) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is [1-(4-chlorobenzoyl)-5-methoxyindazol-3-yl]methanesulfinic acid.
| Compound Name | [1-(4-chlorobenzoyl)-5-methoxyindazol-3-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 123883844 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [1-(4-chlorobenzoyl)-5-methoxyindazol-3-yl]methanesulfinic acid |
| SMILES | COc1ccc2c(c1)c(CS(=O)O)nn2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O4S/c1-23-12-6-7-15-13(8-12)14(9-24(21)22)18-19(15)16(20)10-2-4-11(17)5-3-10/h2-8H,9H2,1H3,(H,21,22) |
| InChIKey | DGQXGLGOOPORDJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|