C22H23ClN4O6 — CID 11340481
(Z)-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxymethoxyimino-(dimethylamino)-oxidoazanium (PubChem CID 11340481) has the molecular formula C22H23ClN4O6 and a molecular weight of 474.90 g/mol. Its IUPAC name is (Z)-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxymethoxyimino-(dimethylamino)-oxidoazanium.
| Compound Name | (Z)-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxymethoxyimino-(dimethylamino)-oxidoazanium |
|---|---|
| PubChem CID | 11340481 |
| Molecular Formula | C22H23ClN4O6 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (Z)-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxymethoxyimino-(dimethylamino)-oxidoazanium |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCO/N=[N+](\[O-])N(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H23ClN4O6/c1-14-18(12-21(28)32-13-33-24-27(30)25(2)3)19-11-17(31-4)9-10-20(19)26(14)22(29)15-5-7-16(23)8-6-15/h5-11H,12-13H2,1-4H3/b27-24- |
| InChIKey | LRFOMIMOOPCTBY-PNHLSOANSA-N |
| XLogP | 3.71 |
| TPSA | 108.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|