About potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride
potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride (PubChem CID 173442022) has the molecular formula C19H17ClKNO4
and a molecular weight of 397.90 g/mol. Its IUPAC name is potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride.
Molecular Properties
| Compound Name | potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride |
| PubChem CID | 173442022 |
| Molecular Formula | C19H17ClKNO4 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride |
| SMILES | COc1ccc2c(c1)c(OC(C)=O)c(C)n2C(=O)c1ccc(Cl)cc1.[H-].[K+] |
| InChI | InChI=1S/C19H16ClNO4.K.H/c1-11-18(25-12(2)22)16-10-15(24-3)8-9-17(16)21(11)19(23)13-4-6-14(20)7-5-13;;/h4-10H,1-3H3;;/q;+1;-1 |
| InChIKey | UMWRFRPOHKBUAY-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride?
The IUPAC name of potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride (CID 173442022) is potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride.
What is the SMILES notation for potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride?
The canonical SMILES for potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride is COc1ccc2c(c1)c(OC(C)=O)c(C)n2C(=O)c1ccc(Cl)cc1.[H-].[K+].
What is the InChIKey of potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride?
The InChIKey is UMWRFRPOHKBUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClNO4.K.H/c1-11-18(25-12(2)22)16-10-15(24-3)8-9-17(16)21(11)19(23)13-4-6-14(20)7-5-13;;/h4-10H,1-3H3;;/q;+1;-1.
What are the key properties of potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride?
potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride has a molecular weight of 397.90 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl] acetate;hydride is sourced from PubChem (CID 173442022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).