C25H20ClNO4 — CID 154136063
benzyl 1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-carboxylate (PubChem CID 154136063) has the molecular formula C25H20ClNO4 and a molecular weight of 433.89 g/mol. Its IUPAC name is benzyl 1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-carboxylate.
| Compound Name | benzyl 1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 154136063 |
| Molecular Formula | C25H20ClNO4 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | benzyl 1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-carboxylate |
| SMILES | COc1ccc2c(c1)c(C(=O)OCc1ccccc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H20ClNO4/c1-16-23(25(29)31-15-17-6-4-3-5-7-17)21-14-20(30-2)12-13-22(21)27(16)24(28)18-8-10-19(26)11-9-18/h3-14H,15H2,1-2H3 |
| InChIKey | COXLDMKQLDITAU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |