C33H26ClNO6 — CID 13217475
benzyl 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxybenzoate (PubChem CID 13217475) has the molecular formula C33H26ClNO6 and a molecular weight of 568.03 g/mol. Its IUPAC name is benzyl 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxybenzoate.
| Compound Name | benzyl 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 13217475 |
| Molecular Formula | C33H26ClNO6 |
| Molecular Weight | 568.03 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | benzyl 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxybenzoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1ccccc1C(=O)OCc1ccccc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H26ClNO6/c1-21-27(28-18-25(39-2)16-17-29(28)35(21)32(37)23-12-14-24(34)15-13-23)19-31(36)41-30-11-7-6-10-26(30)33(38)40-20-22-8-4-3-5-9-22/h3-18H,19-20H2,1-2H3 |
| InChIKey | LFVSLOBJPGZUMP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.03 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|