C26H21Cl2NO4 — CID 68880111
[3-(chloromethyl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 68880111) has the molecular formula C26H21Cl2NO4 and a molecular weight of 482.36 g/mol. Its IUPAC name is [3-(chloromethyl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [3-(chloromethyl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 68880111 |
| Molecular Formula | C26H21Cl2NO4 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | [3-(chloromethyl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1cccc(CCl)c1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H21Cl2NO4/c1-16-22(14-25(30)33-21-5-3-4-17(12-21)15-27)23-13-20(32-2)10-11-24(23)29(16)26(31)18-6-8-19(28)9-7-18/h3-13H,14-15H2,1-2H3 |
| InChIKey | QSSIOKQOVWDUCR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|