C37H32ClF2NO4 — CID 175582836
[3-(1,1-difluoro-6-phenylhex-1-en-2-yl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 175582836) has the molecular formula C37H32ClF2NO4 and a molecular weight of 628.12 g/mol. Its IUPAC name is [3-(1,1-difluoro-6-phenylhex-1-en-2-yl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [3-(1,1-difluoro-6-phenylhex-1-en-2-yl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 175582836 |
| Molecular Formula | C37H32ClF2NO4 |
| Molecular Weight | 628.12 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | [3-(1,1-difluoro-6-phenylhex-1-en-2-yl)phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1cccc(C(CCCCc3ccccc3)=C(F)F)c1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C37H32ClF2NO4/c1-24-32(33-22-29(44-2)19-20-34(33)41(24)37(43)26-15-17-28(38)18-16-26)23-35(42)45-30-13-8-12-27(21-30)31(36(39)40)14-7-6-11-25-9-4-3-5-10-25/h3-5,8-10,12-13,15-22H,6-7,11,14,23H2,1-2H3 |
| InChIKey | ASOSJAOZTJJANF-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.12 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|