C33H37ClN2O4 — CID 77248326
[3-[1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 77248326) has the molecular formula C33H37ClN2O4 and a molecular weight of 561.12 g/mol. Its IUPAC name is [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 77248326 |
| Molecular Formula | C33H37ClN2O4 |
| Molecular Weight | 561.12 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | [3-[1-(dimethylamino)-2-methylpentan-3-yl]phenyl] 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | CCC(c1cccc(OC(=O)Cc2c(C)n(C(=O)c3ccc(Cl)cc3)c3ccc(OC)cc23)c1)C(C)CN(C)C |
| InChI | InChI=1S/C33H37ClN2O4/c1-7-28(21(2)20-35(4)5)24-9-8-10-27(17-24)40-32(37)19-29-22(3)36(31-16-15-26(39-6)18-30(29)31)33(38)23-11-13-25(34)14-12-23/h8-18,21,28H,7,19-20H2,1-6H3 |
| InChIKey | OADBPLUXVXOFAY-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.12 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|