C33H34ClNO7 — CID 46191710
[4-(3,3-dimethylbutoxycarbonyloxy)phenyl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (PubChem CID 46191710) has the molecular formula C33H34ClNO7 and a molecular weight of 592.09 g/mol. Its IUPAC name is [4-(3,3-dimethylbutoxycarbonyloxy)phenyl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate.
| Compound Name | [4-(3,3-dimethylbutoxycarbonyloxy)phenyl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
|---|---|
| PubChem CID | 46191710 |
| Molecular Formula | C33H34ClNO7 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | [4-(3,3-dimethylbutoxycarbonyloxy)phenyl]methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| SMILES | COc1ccc2c(c1)c(CC(=O)OCc1ccc(OC(=O)OCCC(C)(C)C)cc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H34ClNO7/c1-21-27(28-18-26(39-5)14-15-29(28)35(21)31(37)23-8-10-24(34)11-9-23)19-30(36)41-20-22-6-12-25(13-7-22)42-32(38)40-17-16-33(2,3)4/h6-15,18H,16-17,19-20H2,1-5H3 |
| InChIKey | DHVSCTXXPREERV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 93.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|