C33H34ClNO6 — CID 129137938
[7-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3,3-dimethyl-6-oxoheptyl] phenyl carbonate (PubChem CID 129137938) has the molecular formula C33H34ClNO6 and a molecular weight of 576.09 g/mol. Its IUPAC name is [7-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3,3-dimethyl-6-oxoheptyl] phenyl carbonate.
| Compound Name | [7-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3,3-dimethyl-6-oxoheptyl] phenyl carbonate |
|---|---|
| PubChem CID | 129137938 |
| Molecular Formula | C33H34ClNO6 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | [7-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3,3-dimethyl-6-oxoheptyl] phenyl carbonate |
| SMILES | COc1ccc2c(c1)c(CC(=O)CCC(C)(C)CCOC(=O)Oc1ccccc1)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H34ClNO6/c1-22-28(20-25(36)16-17-33(2,3)18-19-40-32(38)41-26-8-6-5-7-9-26)29-21-27(39-4)14-15-30(29)35(22)31(37)23-10-12-24(34)13-11-23/h5-15,21H,16-20H2,1-4H3 |
| InChIKey | OHPDQZHVSLNZPD-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|