C21H19ClN2O5 — CID 57252388
[2-amino-1-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-2-oxoethyl] acetate (PubChem CID 57252388) has the molecular formula C21H19ClN2O5 and a molecular weight of 414.85 g/mol. Its IUPAC name is [2-amino-1-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-2-oxoethyl] acetate.
| Compound Name | [2-amino-1-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 57252388 |
| Molecular Formula | C21H19ClN2O5 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | [2-amino-1-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-2-oxoethyl] acetate |
| SMILES | COc1ccc2c(c1)c(C(OC(C)=O)C(N)=O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O5/c1-11-18(19(20(23)26)29-12(2)25)16-10-15(28-3)8-9-17(16)24(11)21(27)13-4-6-14(22)7-5-13/h4-10,19H,1-3H3,(H2,23,26) |
| InChIKey | LSXRNQVNACXSSN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |