C30H34ClNO4 — CID 54539232
3,7-dimethylocta-2,6-dienyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]propanoate (PubChem CID 54539232) has the molecular formula C30H34ClNO4 and a molecular weight of 508.06 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]propanoate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]propanoate |
|---|---|
| PubChem CID | 54539232 |
| Molecular Formula | C30H34ClNO4 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]propanoate |
| SMILES | COc1ccc2c(c1)c(C(C)C(=O)OCC=C(C)CCC=C(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34ClNO4/c1-19(2)8-7-9-20(3)16-17-36-30(34)21(4)28-22(5)32(27-15-14-25(35-6)18-26(27)28)29(33)23-10-12-24(31)13-11-23/h8,10-16,18,21H,7,9,17H2,1-6H3 |
| InChIKey | ZBYIRYANRXPJHD-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|