C31H34ClNO6 — CID 70413916
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxybutanoic acid (PubChem CID 70413916) has the molecular formula C31H34ClNO6 and a molecular weight of 552.07 g/mol. Its IUPAC name is 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxybutanoic acid.
| Compound Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxybutanoic acid |
|---|---|
| PubChem CID | 70413916 |
| Molecular Formula | C31H34ClNO6 |
| Molecular Weight | 552.07 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-4-[(2E)-3,7-dimethylocta-2,6-dienoyl]oxybutanoic acid |
| SMILES | COc1ccc2c(c1)c(C(CCOC(=O)/C=C(\C)CCC=C(C)C)C(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H34ClNO6/c1-19(2)7-6-8-20(3)17-28(34)39-16-15-25(31(36)37)29-21(4)33(27-14-13-24(38-5)18-26(27)29)30(35)22-9-11-23(32)12-10-22/h7,9-14,17-18,25H,6,8,15-16H2,1-5H3,(H,36,37)/b20-17+ |
| InChIKey | RGZDSYPWDJQIFG-LVZFUZTISA-N |
| XLogP | 7.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.07 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|