C15H11Cl2N3O2 — CID 110169763
(3-amino-6-methoxyindazol-2-yl)-(2,6-dichlorophenyl)methanone (PubChem CID 110169763) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is (3-amino-6-methoxyindazol-2-yl)-(2,6-dichlorophenyl)methanone.
| Compound Name | (3-amino-6-methoxyindazol-2-yl)-(2,6-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 110169763 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (3-amino-6-methoxyindazol-2-yl)-(2,6-dichlorophenyl)methanone |
| SMILES | COc1ccc2c(N)n(C(=O)c3c(Cl)cccc3Cl)nc2c1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-22-8-5-6-9-12(7-8)19-20(14(9)18)15(21)13-10(16)3-2-4-11(13)17/h2-7H,18H2,1H3 |
| InChIKey | ZHCBZMAQHSVGPU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |