C22H28N2O4 — CID 168798775
methyl 5-[3-[(4-methoxyphenyl)methyl]-4-oxo-5,6,7,8-tetrahydrophthalazin-1-yl]pentanoate (PubChem CID 168798775) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is methyl 5-[3-[(4-methoxyphenyl)methyl]-4-oxo-5,6,7,8-tetrahydrophthalazin-1-yl]pentanoate.
| Compound Name | methyl 5-[3-[(4-methoxyphenyl)methyl]-4-oxo-5,6,7,8-tetrahydrophthalazin-1-yl]pentanoate |
|---|---|
| PubChem CID | 168798775 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | methyl 5-[3-[(4-methoxyphenyl)methyl]-4-oxo-5,6,7,8-tetrahydrophthalazin-1-yl]pentanoate |
| SMILES | COC(=O)CCCCc1nn(Cc2ccc(OC)cc2)c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C22H28N2O4/c1-27-17-13-11-16(12-14-17)15-24-22(26)19-8-4-3-7-18(19)20(23-24)9-5-6-10-21(25)28-2/h11-14H,3-10,15H2,1-2H3 |
| InChIKey | WPTXMGBYWOXEPI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|