C23H25ClN2O5 — CID 165393183
methyl 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoate (PubChem CID 165393183) has the molecular formula C23H25ClN2O5 and a molecular weight of 444.92 g/mol. Its IUPAC name is methyl 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoate.
| Compound Name | methyl 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoate |
|---|---|
| PubChem CID | 165393183 |
| Molecular Formula | C23H25ClN2O5 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | methyl 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoate |
| SMILES | COC(=O)CCCOC(C)c1cc(Cl)cc2c(=O)n(Cc3ccc(OC)cc3)ncc12 |
| InChI | InChI=1S/C23H25ClN2O5/c1-15(31-10-4-5-22(27)30-3)19-11-17(24)12-20-21(19)13-25-26(23(20)28)14-16-6-8-18(29-2)9-7-16/h6-9,11-13,15H,4-5,10,14H2,1-3H3 |
| InChIKey | WPHXJKKPGHTWMS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|