C22H23ClN2O5 — CID 165392914
4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoic acid (PubChem CID 165392914) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoic acid.
| Compound Name | 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 165392914 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 4-[1-[7-chloro-2-[(4-methoxyphenyl)methyl]-1-oxophthalazin-5-yl]ethoxy]butanoic acid |
| SMILES | COc1ccc(Cn2ncc3c(C(C)OCCCC(=O)O)cc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C22H23ClN2O5/c1-14(30-9-3-4-21(26)27)18-10-16(23)11-19-20(18)12-24-25(22(19)28)13-15-5-7-17(29-2)8-6-15/h5-8,10-12,14H,3-4,9,13H2,1-2H3,(H,26,27) |
| InChIKey | MNHXNFCSHMTNHX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|