About 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride
7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride (PubChem CID 46877427) has the molecular formula C16H11BrClN3O2
and a molecular weight of 392.64 g/mol. Its IUPAC name is 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride.
Molecular Properties
| Compound Name | 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride |
| PubChem CID | 46877427 |
| Molecular Formula | C16H11BrClN3O2 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride |
| SMILES | Cl.Cn1c2c3cc(Br)cc([N+](=O)[O-])c3nc-2cc2ccccc21 |
| InChI | InChI=1S/C16H10BrN3O2.ClH/c1-19-13-5-3-2-4-9(13)6-12-16(19)11-7-10(17)8-14(20(21)22)15(11)18-12;/h2-8H,1H3;1H |
| InChIKey | JGKMDXNNJFNPRI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride?
The IUPAC name of 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride (CID 46877427) is 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride.
What is the SMILES notation for 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride?
The canonical SMILES for 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride is Cl.Cn1c2c3cc(Br)cc([N+](=O)[O-])c3nc-2cc2ccccc21.
What is the InChIKey of 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride?
The InChIKey is JGKMDXNNJFNPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrN3O2.ClH/c1-19-13-5-3-2-4-9(13)6-12-16(19)11-7-10(17)8-14(20(21)22)15(11)18-12;/h2-8H,1H3;1H.
What are the key properties of 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride?
7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride has a molecular weight of 392.64 g/mol, XLogP of 4.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-methyl-9-nitroindolo[3,2-b]quinoline;hydrochloride is sourced from PubChem (CID 46877427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).