About 2,7-dibromo-5-methylindolo[3,2-b]quinoline
2,7-dibromo-5-methylindolo[3,2-b]quinoline (PubChem CID 10023257) has the molecular formula C16H10Br2N2
and a molecular weight of 390.08 g/mol. Its IUPAC name is 2,7-dibromo-5-methylindolo[3,2-b]quinoline.
Molecular Properties
| Compound Name | 2,7-dibromo-5-methylindolo[3,2-b]quinoline |
| PubChem CID | 10023257 |
| Molecular Formula | C16H10Br2N2 |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 2,7-dibromo-5-methylindolo[3,2-b]quinoline |
| SMILES | Cn1c2c3cc(Br)ccc3nc-2cc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H10Br2N2/c1-20-15-5-3-10(17)6-9(15)7-14-16(20)12-8-11(18)2-4-13(12)19-14/h2-8H,1H3 |
| InChIKey | JXZJTCBXPUJTCV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,7-dibromo-5-methylindolo[3,2-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-5-methylindolo[3,2-b]quinoline?
The IUPAC name of 2,7-dibromo-5-methylindolo[3,2-b]quinoline (CID 10023257) is 2,7-dibromo-5-methylindolo[3,2-b]quinoline.
What is the SMILES notation for 2,7-dibromo-5-methylindolo[3,2-b]quinoline?
The canonical SMILES for 2,7-dibromo-5-methylindolo[3,2-b]quinoline is Cn1c2c3cc(Br)ccc3nc-2cc2cc(Br)ccc21.
What is the InChIKey of 2,7-dibromo-5-methylindolo[3,2-b]quinoline?
The InChIKey is JXZJTCBXPUJTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Br2N2/c1-20-15-5-3-10(17)6-9(15)7-14-16(20)12-8-11(18)2-4-13(12)19-14/h2-8H,1H3.
What are the key properties of 2,7-dibromo-5-methylindolo[3,2-b]quinoline?
2,7-dibromo-5-methylindolo[3,2-b]quinoline has a molecular weight of 390.08 g/mol, XLogP of 5.36, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-5-methylindolo[3,2-b]quinoline is sourced from PubChem (CID 10023257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).