C9H10BrN3 — CID 84629605
6-bromo-N,1-dimethylbenzimidazol-2-amine (PubChem CID 84629605) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 6-bromo-N,1-dimethylbenzimidazol-2-amine.
| Compound Name | 6-bromo-N,1-dimethylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 84629605 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 6-bromo-N,1-dimethylbenzimidazol-2-amine |
| SMILES | CNc1nc2ccc(Br)cc2n1C |
| InChI | InChI=1S/C9H10BrN3/c1-11-9-12-7-4-3-6(10)5-8(7)13(9)2/h3-5H,1-2H3,(H,11,12) |
| InChIKey | HSRSTKAQSLREQD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |