C15H13Br2N3 — CID 114375973
[2-(2,5-dibromophenyl)-3-methylbenzimidazol-5-yl]methanamine (PubChem CID 114375973) has the molecular formula C15H13Br2N3 and a molecular weight of 395.10 g/mol. Its IUPAC name is [2-(2,5-dibromophenyl)-3-methylbenzimidazol-5-yl]methanamine.
| Compound Name | [2-(2,5-dibromophenyl)-3-methylbenzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 114375973 |
| Molecular Formula | C15H13Br2N3 |
| Molecular Weight | 395.10 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | [2-(2,5-dibromophenyl)-3-methylbenzimidazol-5-yl]methanamine |
| SMILES | Cn1c(-c2cc(Br)ccc2Br)nc2ccc(CN)cc21 |
| InChI | InChI=1S/C15H13Br2N3/c1-20-14-6-9(8-18)2-5-13(14)19-15(20)11-7-10(16)3-4-12(11)17/h2-7H,8,18H2,1H3 |
| InChIKey | RZJOWKIDGHLWTE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.10 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |