C10H9IN2O2 — CID 118865624
3-iodo-1,4-dimethyl-5-nitroindole (PubChem CID 118865624) has the molecular formula C10H9IN2O2 and a molecular weight of 316.10 g/mol. Its IUPAC name is 3-iodo-1,4-dimethyl-5-nitroindole.
| Compound Name | 3-iodo-1,4-dimethyl-5-nitroindole |
|---|---|
| PubChem CID | 118865624 |
| Molecular Formula | C10H9IN2O2 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 3-iodo-1,4-dimethyl-5-nitroindole |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1c(I)cn2C |
| InChI | InChI=1S/C10H9IN2O2/c1-6-8(13(14)15)3-4-9-10(6)7(11)5-12(9)2/h3-5H,1-2H3 |
| InChIKey | BWVRSVTUJSTENK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|