C16H17N3O4 — CID 141433423
4-(1,4-dimethyl-5-nitroindol-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 141433423) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-(1,4-dimethyl-5-nitroindol-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-(1,4-dimethyl-5-nitroindol-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 141433423 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-(1,4-dimethyl-5-nitroindol-3-yl)-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | Cc1c([N+](=O)[O-])ccc2c1c(C1=CCN(C(=O)O)CC1)cn2C |
| InChI | InChI=1S/C16H17N3O4/c1-10-13(19(22)23)3-4-14-15(10)12(9-17(14)2)11-5-7-18(8-6-11)16(20)21/h3-5,9H,6-8H2,1-2H3,(H,20,21) |
| InChIKey | IQPINJNYWFKDSN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|