C7H2Cl3N — CID 19800061
2,3,5-trichlorobenzonitrile (PubChem CID 19800061) has the molecular formula C7H2Cl3N and a molecular weight of 206.46 g/mol. Its IUPAC name is 2,3,5-trichlorobenzonitrile.
| Compound Name | 2,3,5-trichlorobenzonitrile |
|---|---|
| PubChem CID | 19800061 |
| Molecular Formula | C7H2Cl3N |
| Molecular Weight | 206.46 g/mol |
| Exact Mass | 204.93 |
| IUPAC Name | 2,3,5-trichlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C7H2Cl3N/c8-5-1-4(3-11)7(10)6(9)2-5/h1-2H |
| InChIKey | MMDWDMLGGFMMCQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|