About 5-acetyl-2,3-dichlorobenzonitrile
5-acetyl-2,3-dichlorobenzonitrile (PubChem CID 171007860) has the molecular formula C9H5Cl2NO
and a molecular weight of 214.05 g/mol. Its IUPAC name is 5-acetyl-2,3-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 5-acetyl-2,3-dichlorobenzonitrile |
| PubChem CID | 171007860 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 5-acetyl-2,3-dichlorobenzonitrile |
| SMILES | CC(=O)c1cc(Cl)c(Cl)c(C#N)c1 |
| InChI | InChI=1S/C9H5Cl2NO/c1-5(13)6-2-7(4-12)9(11)8(10)3-6/h2-3H,1H3 |
| InChIKey | PJXRKOQBKDQDGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-acetyl-2,3-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-2,3-dichlorobenzonitrile?
The IUPAC name of 5-acetyl-2,3-dichlorobenzonitrile (CID 171007860) is 5-acetyl-2,3-dichlorobenzonitrile.
What is the SMILES notation for 5-acetyl-2,3-dichlorobenzonitrile?
The canonical SMILES for 5-acetyl-2,3-dichlorobenzonitrile is CC(=O)c1cc(Cl)c(Cl)c(C#N)c1.
What is the InChIKey of 5-acetyl-2,3-dichlorobenzonitrile?
The InChIKey is PJXRKOQBKDQDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NO/c1-5(13)6-2-7(4-12)9(11)8(10)3-6/h2-3H,1H3.
What are the key properties of 5-acetyl-2,3-dichlorobenzonitrile?
5-acetyl-2,3-dichlorobenzonitrile has a molecular weight of 214.05 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2,3-dichlorobenzonitrile is sourced from PubChem (CID 171007860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).