C13H5Cl4N — CID 134630536
3-chloro-2-(2,3,5-trichlorophenyl)benzonitrile (PubChem CID 134630536) has the molecular formula C13H5Cl4N and a molecular weight of 317.00 g/mol. Its IUPAC name is 3-chloro-2-(2,3,5-trichlorophenyl)benzonitrile.
| Compound Name | 3-chloro-2-(2,3,5-trichlorophenyl)benzonitrile |
|---|---|
| PubChem CID | 134630536 |
| Molecular Formula | C13H5Cl4N |
| Molecular Weight | 317.00 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | 3-chloro-2-(2,3,5-trichlorophenyl)benzonitrile |
| SMILES | N#Cc1cccc(Cl)c1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl4N/c14-8-4-9(13(17)11(16)5-8)12-7(6-18)2-1-3-10(12)15/h1-5H |
| InChIKey | ROSPTRLATKQZTF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.00 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|