About 3-chloro-2-(2,3,5-trichlorophenyl)aniline
3-chloro-2-(2,3,5-trichlorophenyl)aniline (PubChem CID 119002694) has the molecular formula C12H7Cl4N
and a molecular weight of 307.01 g/mol. Its IUPAC name is 3-chloro-2-(2,3,5-trichlorophenyl)aniline.
Molecular Properties
| Compound Name | 3-chloro-2-(2,3,5-trichlorophenyl)aniline |
| PubChem CID | 119002694 |
| Molecular Formula | C12H7Cl4N |
| Molecular Weight | 307.01 g/mol |
| Exact Mass | 304.93 |
| IUPAC Name | 3-chloro-2-(2,3,5-trichlorophenyl)aniline |
| SMILES | Nc1cccc(Cl)c1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C12H7Cl4N/c13-6-4-7(12(16)9(15)5-6)11-8(14)2-1-3-10(11)17/h1-5H,17H2 |
| InChIKey | UUZLQOGQCRQBPI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.01 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-(2,3,5-trichlorophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-(2,3,5-trichlorophenyl)aniline?
The IUPAC name of 3-chloro-2-(2,3,5-trichlorophenyl)aniline (CID 119002694) is 3-chloro-2-(2,3,5-trichlorophenyl)aniline.
What is the SMILES notation for 3-chloro-2-(2,3,5-trichlorophenyl)aniline?
The canonical SMILES for 3-chloro-2-(2,3,5-trichlorophenyl)aniline is Nc1cccc(Cl)c1-c1cc(Cl)cc(Cl)c1Cl.
What is the InChIKey of 3-chloro-2-(2,3,5-trichlorophenyl)aniline?
The InChIKey is UUZLQOGQCRQBPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl4N/c13-6-4-7(12(16)9(15)5-6)11-8(14)2-1-3-10(11)17/h1-5H,17H2.
What are the key properties of 3-chloro-2-(2,3,5-trichlorophenyl)aniline?
3-chloro-2-(2,3,5-trichlorophenyl)aniline has a molecular weight of 307.01 g/mol, XLogP of 5.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(2,3,5-trichlorophenyl)aniline is sourced from PubChem (CID 119002694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).