C10H6Cl3NO — CID 170472839
4-(2,3,5-trichlorophenyl)but-3-ynamide (PubChem CID 170472839) has the molecular formula C10H6Cl3NO and a molecular weight of 262.52 g/mol. Its IUPAC name is 4-(2,3,5-trichlorophenyl)but-3-ynamide.
| Compound Name | 4-(2,3,5-trichlorophenyl)but-3-ynamide |
|---|---|
| PubChem CID | 170472839 |
| Molecular Formula | C10H6Cl3NO |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 4-(2,3,5-trichlorophenyl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C10H6Cl3NO/c11-7-4-6(2-1-3-9(14)15)10(13)8(12)5-7/h4-5H,3H2,(H2,14,15) |
| InChIKey | QVWBFNHVDMRPIG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|